This compound is a research reagent designed for click chemistry applications, featuring an azadibenzocyclooctyne (ADIBO) group linked to a carboxylic acid via a polyethylene glycol (PEG) spacer. Its structure enables copper-free strain-promoted azide-alkyne cycloaddition (SPAAC), making it suitable for bioconjugation and labeling studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1537170-85-6
DBCO-PEG4-NHS ester
click chemistry crosslinking reagent
2-(chloromethyl)-4-phenoxybenzoyl chloride
Research chemical intermediate
Tris(2,2'-bipyridine)nickel(II) bromide
cross-coupling catalyst precursor
Trimethylacetic anhydride
Research reagent for organic synthesis
L-Glutamine, N2-((1,1-dimethylethoxy)carbonyl)-, 4-nitrophenyl ester
peptide synthesis intermediate
11,12-Didehydro-gamma-oxodibenz[b,f]azocine-5(6H)-butanoic acid
click chemistry reagent
DBCO-(CH2)3-Acid
click chemistry reagent
Dibenzocyclooctyne-amine
click chemistry reagent
3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
LKSAMQQFMTVPKD-UHFFFAOYSA-N
C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCC(=O)NCCOCCOCCOCCOCCC(=O)O