DBCO-PEG4-NHS ester is a research reagent used in click chemistry crosslinking, featuring a strained alkyne (DBCO) group that enables copper-free azide-alkyne cycloaddition. Its PEG4 spacer improves solubility and flexibility, while the NHS ester group allows selective conjugation to primary amines.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1427004-19-0
DBCO-CONH-S-S-NHS ester
click chemistry conjugation reagent
3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
research compound for click chemistry
Dbco-nhs ester
Copper-free click chemistry reagent
(7-(4-(4-(Benzo[b]thiophen-4-yl)piperazin-1-yl)butoxy)quinolin-2-yloxy)methyl cyclohexyl carbonate
research compound
(7-(4-(4-(Benzo[b]thiophen-4-yl)piperazin-1-yl)butoxy)-2-oxoquinolin-1(2h)-yl)methyl cyclohexyl carbonate hydrochloride
Research compound with piperazine linker
Methyl 5-chloropentanoate
research compound
Methyl 6-bromohexanoate
Organic synthesis building block
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate
RRCXYKNJTKJNTD-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)CCC(=O)N2CC3=CC=CC=C3C#CC4=CC=CC=C42