(4-Isobutylphenyl)boronic acid is a boronic acid derivative featuring an aromatic ring substituted with an isobutyl group. It is commonly used as a research reagent in organic synthesis and medicinal chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 153624-38-5
Sec-Butylmagnesium chloride
Grignard reagent for organic synthesis
Creatine Ethyl Ester HCL
research compound
Methyl 1H-pyrazole-3-carboxylate
research compound
3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
research compound for click chemistry
[4-(2-methylpropyl)phenyl]boronic acid
YZSPHVWALUJQNK-UHFFFAOYSA-N
B(C1=CC=C(C=C1)CC(C)C)(O)O