Platinum(II) acetylacetonate is a research compound used in platinum chemistry. It consists of a platinum center coordinated with two acetylacetonate ligands and is typically employed as a laboratory reagent.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Platinum(II) acetylacetonate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Ruthenium(III) acetylacetonate
coordination chemistry research reagent
Rp-cAMPS triethylammonium salt
research compound
2,4-Butanedione, 1,1,1-trifluoro-4-(4-methoxyphenyl)-
Organic synthesis intermediate
1-(4-Chloro-2-(2-fluorobenzoyl)phenyl)-2-methyl-1H-imidazole-5-carboxylic Acid
Impurity of midazolam reference standard
2-(Methyl-d3)-aniline
Deuterated research reagent
2,4-Pentanedione, ion(1-), calcium
calcium acetylacetonate as metal precursor
Iron(III) acetylacetonate
coordination chemistry research reagent
Rhodium(III) 2,4-pentanedionate
Research reagent and reference standard
bis((Z)-4-hydroxypent-3-en-2-one);platinum
VEJOYRPGKZZTJW-FDGPNNRMSA-N
C/C(=C/C(=O)C)/O.C/C(=C/C(=O)C)/O.[Pt]
Platinum(II) acetylacetonate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.