4-(Chlorosulfonyl)phenyl 2,2-dimethylpropanoate is a research compound featuring an aromatic ring, an ester group, and a sulfonyl chloride moiety. Its structure includes a chlorine atom and a branched ester substituent, contributing to its polarity and moderate lipophilicity.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 150374-99-5
2-Fluoro-6-methoxybenzylamine
research compound
(1,1,2,2-2H4)Ethane-1,2-(2H2)diol
deuterated NMR standard
(2Z)-[(4S)-4-Phenyl-4,5-dihydro-1,3-oxazol-2-yl][(4S)-4-phenyl-1,3-oxazolidin-2-ylidene]acetonitrile
research compound
1,1,2,2,3,4,5,6,7,8-decadeuterioacenaphthylene
Deuterated analytical reference standard
(4-chlorosulfonylphenyl) 2,2-dimethylpropanoate
BSRSTUAZWZWGRT-UHFFFAOYSA-N
CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)Cl