This compound is a protected derivative of D-penicillamine, featuring a trityl (triphenylmethyl) group attached to the sulfur atom. It is used as a building block in solid-phase peptide synthesis, where the trityl group serves as a protective group for the thiol functionality.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 150025-01-7
Fmoc-Ile-Aib-OH
Peptide building block for synthesis
(2S)-2-{[(tert-butoxy)carbonyl]amino}-4-phenylbutanoic acid
Peptide building block for synthesis
Methyl 2-ethoxy-1H-benzimidazole-4-carboxylate
Pharmaceutical intermediate
Trans-5-((benzyloxy)amino)piperidine-2-carboxylicacid
Pharmaceutical intermediate for drug synthesis
Ethyl 2,6-difluoro-3-nitrobenzoate
Pharmaceutical intermediate
Benzoic acid, 2-amino-6-fluoro-3-nitro-, ethyl ester
pharmaceutical intermediate
(2S)-2-amino-3-methyl-3-tritylsulfanylbutanoic acid
XSOLHQWRHYIXOC-NRFANRHFSA-N
CC(C)([C@H](C(=O)O)N)SC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3