This compound is a protected amino acid derivative used as a building block in peptide synthesis. Its structure incorporates a tert-butoxycarbonyl (Boc) protecting group and a homophenylalanine backbone, making it suitable for solid-phase or solution-phase peptide assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 100564-78-1
H-D-PEN(TRT)-OH
Peptide building block for synthesis
Fmoc-Ile-Aib-OH
Peptide building block for synthesis
5-Nitroso-2,4,6-triaminopyrimidine
pharmaceutical intermediate for folic acid and drugs
2-Bromo-4-fluorobenzoic acid
Pharmaceutical intermediate for drug synthesis
O-Acetyl Losartan
pharmaceutical intermediate impurity
(alphaS)-alpha-(Chloromethyl)-3,4-difluorobenzenemethanol
Pharmaceutical intermediate
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid
MCODLPJUFHPVQP-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CCC1=CC=CC=C1)C(=O)O