Sabutamol dimer is a chemical compound used as an impurity reference standard for albuterol (salbutamol). It consists of two albuterol-like units linked through an ether bridge, featuring multiple hydroxyl and amine functional groups.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Sabutamol dimer 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-(2-(tert-Butylamino)-1-hydroxyethyl)-2-(methoxymethyl)phenol
Beta-2 adrenergic receptor agonist
Palmitoyl Tripeptide-1
cosmetic anti-aging ingredient
Beta-D-glucosaminyl-(1->4)-beta-D-glucosamine
chitosan oligosaccharide building block
Tetraoctylammonium bromide
Phase transfer catalyst
N-Nitroso Clonidine
Nitrosamine impurity standard
4-[2-(tert-butylamino)-1-hydroxyethyl]-2-[[5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxyphenyl]methoxymethyl]phenol
DOEYIHXSVMYOHZ-UHFFFAOYSA-N
CC(C)(C)NCC(C1=CC(=C(C=C1)O)COCC2=C(C=CC(=C2)C(CNC(C)(C)C)O)O)O
Sabutamol dimer 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.