4-Bromo-1-naphthaleneboronic acid is a boronic acid compound used as a research reagent in laboratory settings. Its structure features a bromine-substituted naphthalene ring with a boronic acid group, giving it properties suitable for organic synthesis and cross-coupling reactions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 145965-14-6
4-Benzyloxy-phenylboronic acid
Boronic acid research reagent
4-Acetylphenylboronic acid
Boronic acid research reagent
B-Hexylboronic acid
Boronic acid research reagent
2-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
Flavin adenine dinucleotide
redox-active coenzyme
2-Fluoroadenosine
research nucleoside analog
3-Methyl-2-oxovaleric acid
Clinical marker for maple syrup urine disease
2-(PIVALAMIDO)PHENYLBORONIC ACID
research compound
(4-bromonaphthalen-1-yl)boronic acid
DKKOMUVRCPKTFX-UHFFFAOYSA-N
B(C1=CC=C(C2=CC=CC=C12)Br)(O)O
—