This compound is a deuterated form of urea where all four hydrogen atoms of the amino groups are replaced by deuterium. It is primarily used as a research reagent in isotopic labeling studies and as an intermediate in pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1433-11-0
1,2,2,3,3,4,4,5,5,6,6-undecadeuteriopiperidine
Deuterated NMR reference standard
Mal-PEG2-NHS ester
heterobifunctional crosslinking reagent
6-Methoxy-5-methylpyrimidin-4-ol
research compound
DL-Aspartic acid-d3
deuterated amino acid research reagent
요소 (화학)
Nitrogen fertilizer
Urea-13C,15N2
stable isotope labeled research compound
1,1,3,3-tetradeuteriourea
XSQUKJJJFZCRTK-JBISRTOLSA-N
[2H]N([2H])C(=O)N([2H])[2H]