Phenoxyacetic anhydride is a chemical compound used primarily as a research reagent. It consists of two phenoxyacetate groups linked by an anhydride bond, giving it a structure with aromatic rings and ether linkages.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 14316-61-1
3-Cyclopenten-1-one
Research reagent
5'-Deshydroxy 5'-Chloro L-Adenosine
research compound
N-(4-(5-Hydroxy-2,3,4,5-tetrahydro-1H-benzo[b]azepine-1-carbonyl)-3-methylphenyl)-2-methylbenzamide
research compound
(2H4)Urea
deuterated research reagent
(2-phenoxyacetyl) 2-phenoxyacetate
CCSBNBKMACZDGN-UHFFFAOYSA-N
C1=CC=C(C=C1)OCC(=O)OC(=O)COC2=CC=CC=C2