Thailanstatin C is a research compound, typically used as a laboratory reagent. It is a structurally complex molecule containing multiple functional groups and is investigated for its potential in scientific studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1426953-24-3
Thailanstatin B
research compound
Thailanstatin A
pharmaceutical intermediate from Burkholderia thailandensis
Methyl 6-fluoropyridine-3-carboxylate
research reagent for PET radiotracer
DBCO-PEG4-NHS ester
click chemistry crosslinking reagent
(7-(4-(4-(Benzo[b]thiophen-4-yl)piperazin-1-yl)butoxy)quinolin-2-yloxy)methyl cyclohexyl carbonate
research compound
(7-(4-(4-(Benzo[b]thiophen-4-yl)piperazin-1-yl)butoxy)-2-oxoquinolin-1(2h)-yl)methyl cyclohexyl carbonate hydrochloride
Research compound with piperazine linker
(2Z,4S)-4-(Acetyloxy)-N-((2R,3R,5S,6S)-6-((2E,4E)-5-((2R,3R,4S,6S)-4-(chloromethyl)tetrahydro-3,4,6-trihydroxy-6-methyl-2H-pyran-2-yl)-3-methyl-2,4-pentadien-1-yl)tetrahydro-2,5-dimethyl-2H-pyran-3-yl)-2-pentenamide
n.a
2-[(2S,4S,5R,6R)-4-(chloromethyl)-6-[(1E,3E)-5-[(2S,3S,5R,6R)-3,6-dimethyl-5-[[(Z,4S)-4-(2-methylpropanoyloxy)pent-2-enoyl]amino]oxan-2-yl]-3-methylpenta-1,3-dienyl]-4,5-dihydroxyoxan-2-yl]acetic acid
IUEAQIHFZAHMMU-WEDQMBCXSA-N
C[C@H]1C[C@H]([C@H](O[C@H]1C/C=C(\C)/C=C/[C@@H]2[C@H]([C@@](C[C@H](O2)CC(=O)O)(CCl)O)O)C)NC(=O)/C=C\[C@H](C)OC(=O)C(C)C