1-Bromo-3,4,5-trifluoro-2-nitrobenzene is a brominated and fluorinated nitroaromatic compound used primarily as a research chemical intermediate. Its structure features an aromatic ring with bromine, fluorine, and nitro substituents, contributing to its polarity and reactivity in synthetic chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
1-Bromo-3,4,5-trifluoro-2-nitrobenzene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2,4-Bis(trifluoromethyl)phenylboronic acid
research chemical intermediate
1-bromo-4-propoxybenzene
research chemical intermediate
1,6-dibromonaphthalen-2-amine
research chemical intermediate
Ethyl 2-oxocyclohexanecarboxylate
research chemical intermediate
Cys(Npys)-(Arg)9
research compound
Crown 18
Crown ether ligand
2-((tert-Butoxycarbonyl)(methyl)amino)benzoic acid
research compound
Methyl 1,4-dihydroxy-7-phenoxyisoquinoline-3-carboxylate
research compound
1-bromo-3,4,5-trifluoro-2-nitrobenzene
LTQKIGJLQQCSLS-UHFFFAOYSA-N
C1=C(C(=C(C(=C1Br)[N+](=O)[O-])F)F)F
—
1-Bromo-3,4,5-trifluoro-2-nitrobenzene 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.