This compound is a research reagent, specifically a protected amino acid derivative featuring a benzoic acid core with an N-methyl and tert-butoxycarbonyl (Boc) protecting group. Its significance lies in its use as a building block for peptide synthesis and other organic chemistry applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 141871-02-5
Methyl 1,4-dihydroxy-7-phenoxyisoquinoline-3-carboxylate
research compound
Methyl 1-chloro-4-hydroxy-7-phenoxyisoquinoline-3-carboxylate
research compound
2-Bromo-6-fluorotoluene
Research reagent for organic synthesis
Bis(benzonitrile)palladium chloride
coordination complex and catalyst precursor
2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid
UXLICAHPTWWCII-UHFFFAOYSA-N
CC(C)(C)OC(=O)N(C)C1=CC=CC=C1C(=O)O