4-Carboxyphenylboronic acid is a boronic acid derivative containing both a carboxylic acid and a boronic acid functional group on an aromatic ring. It is primarily used as a synthetic building block in organic chemistry, particularly for cross-coupling reactions and the construction of more complex molecules.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Carboxyphenylboronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Ethyl (4-chlorophenyl)acetate
research chemical
Selectfluor
electrophilic fluorinating agent
3-O-tert-Butyldimethylsilyl Calcifediol
Research compound for vitamin D metabolites
(R)-6-((1R,3aS,7aR,E)-4-((Z)-2-((3S,5R)-3,5-bis(tert-butyldimethylsilyloxy)-2-methylenecyclohexylidene)ethylidene)-7a-methyloctahydro-1H-inden-1-yl)-2-methylheptan-2-ol
Research reagent
4-boronobenzoic acid
SIAVMDKGVRXFAX-UHFFFAOYSA-N
B(C1=CC=C(C=C1)C(=O)O)(O)O
4-Carboxyphenylboronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.