3-O-tert-Butyldimethylsilyl Calcifediol is a synthetic derivative of calcifediol, a major vitamin D metabolite, modified with a tert-butyldimethylsilyl protecting group at the 3-position. It is primarily used as a research reagent for studying vitamin D metabolism and analytical chemistry applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3-O-tert-Butyldimethylsilyl Calcifediol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Silane, (1,1-dimethylethyl)dimethyl[[(3beta,5E,7E)-9,10-secocholesta-5,7,10(19)-trien-3-yl]oxy]-
Vitamin D intermediate synthesis
(R)-6-((1R,3aS,7aR,E)-4-((Z)-2-((3S,5R)-3,5-bis(tert-butyldimethylsilyloxy)-2-methylenecyclohexylidene)ethylidene)-7a-methyloctahydro-1H-inden-1-yl)-2-methylheptan-2-ol
Research reagent
Calcifediol
active pharmaceutical ingredient
Calcifediol (monohydrate)
Active pharmaceutical ingredient
Dichloronickel;pyridine
research compound
Cis-4-(1,2,3,4-Tetrahydro-6-methoxy-2-phenyl-1-naphthalenyl)phenol
research compound
Magnesium, bromo-1-propenyl-
Grignard reagent for organic synthesis
Benzo-18-crown 6-Ether
crown ether for metal ion complexation
(6R)-6-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-2-methylheptan-2-ol
CTZMHDJIUFEYKE-NXMZLKDESA-N
C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](CCC3=C)O[Si](C)(C)C(C)(C)C)C
3-O-tert-Butyldimethylsilyl Calcifediol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.