DBCO-Maleimide is a bifunctional compound that combines a dibenzocyclooctyne (DBCO) group for copper-free click chemistry with a maleimide group for thiol-specific conjugation. It is primarily used as a reagent for bioorthogonal labeling and bioconjugation without the need for cytotoxic copper catalysts.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1395786-30-7
Dibenzocyclooctyne-PEG4 maleimide
Copper-free click chemistry reagent
3,5-Dichloroisonicotinic acid
research compound
Ethyl 3-bromoisonicotinate
research compound
Dichlorobis(triphenylphosphine)palladium
catalyst for coupling reactions
2-CHLOROANISOLE-D3 (METHYL-D3)
deuterated research compound
N-[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]-3-(2,5-dioxopyrrol-1-yl)propanamide
NHFQNAGPXIVKND-UHFFFAOYSA-N
C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCNC(=O)CCN4C(=O)C=CC4=O