3,5-Dichloroisonicotinic acid is a chlorinated derivative of isonicotinic acid featuring two chlorine substituents on the pyridine ring. This compound is primarily utilized as a research reagent in coordination chemistry and materials science, notably in the synthesis of uranyl–organic frameworks with halogen-bonding interactions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3,5-Dichloroisonicotinic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Ethyl 3-bromoisonicotinate
research compound
Dichlorobis(triphenylphosphine)palladium
catalyst for coupling reactions
2-CHLOROANISOLE-D3 (METHYL-D3)
deuterated research compound
BIS(2-METHOXYETHYL) PHTHALATE-3,4,5,6-D4
deuterated analytical reference standard
3,5-dichloropyridine-4-carboxylic acid
BUQPTOSHKHYHHB-UHFFFAOYSA-N
C1=C(C(=C(C=N1)Cl)C(=O)O)Cl
3,5-Dichloroisonicotinic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.