N-(tert-Butoxycarbonyl)-L-aspartic acid is a protected derivative of L-aspartic acid commonly used in peptide synthesis. It serves as a pharmaceutical intermediate, where the tert-butoxycarbonyl (Boc) group protects the amino function during peptide chain assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
N-(tert-Butoxycarbonyl)-L-aspartic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Boc-Asp(OtBu)-OH
protected amino acid for peptide synthesis
(3S)-4-(tert-butoxy)-3-{[(tert-butoxy)carbonyl]amino}-4-oxobutanoic acid
Protected aspartic acid derivative
L-Asparagine, N2-[(1,1-dimethylethoxy)carbonyl]-
peptide synthesis intermediate
Boc-D-asparagine
peptide building block
(2S,4R)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
Protected amino acid building block
(2S)-5-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
protected amino acid intermediate
Boc-L-glutamine
protected amino acid for peptide synthesis
Pemetrexed acid
pharmaceutical intermediate
N-(tert-Butoxycarbonyl)-L-aspartic acid(CAS 13726-67-5)의 국제 HS 코드는 2924.19입니다.
2924.19
2924 19 00
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioic acid
KAJBMCZQVSQJDE-YFKPBYRVSA-N
CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C(=O)O
N-(tert-Butoxycarbonyl)-L-aspartic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.