N-(tert-Butoxycarbonyl)-L-aspartic acid is a protected derivative of L-aspartic acid commonly used in peptide synthesis. It serves as a pharmaceutical intermediate, where the tert-butoxycarbonyl (Boc) group protects the amino function during peptide chain assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13726-67-5
Boc-Asp(OtBu)-OH
protected amino acid for peptide synthesis
(3S)-4-(tert-butoxy)-3-{[(tert-butoxy)carbonyl]amino}-4-oxobutanoic acid
Protected aspartic acid derivative
L-Asparagine, N2-[(1,1-dimethylethoxy)carbonyl]-
peptide synthesis intermediate
Boc-D-asparagine
peptide building block
(2S,4R)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
Protected amino acid building block
(2S)-5-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
protected amino acid intermediate
Boc-L-glutamine
protected amino acid for peptide synthesis
Pemetrexed acid
pharmaceutical intermediate
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioic acid
KAJBMCZQVSQJDE-YFKPBYRVSA-N
CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C(=O)O