TDCPP (tris(1,3-dichloroisopropyl)phosphate) is a chlorinated organophosphate compound primarily used as a flame retardant in polyurethane foams. It is structurally related to other chlorinated flame retardants such as TCEP and TCPP.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13674-87-8
1,1'-(Methylenedi-p-phenylene)bismaleimide
intermediate for polymer synthesis
2,2,3,3,4,4,4-Heptafluorobutyl methacrylate
fluorinated monomer for polymer synthesis
2-Aminothiophenol
synthesis intermediate for chemical industry
N-Lauroylsarcosine sodium salt
surfactant and foaming agent
tris(1,3-dichloropropan-2-yl) phosphate
ASLWPAWFJZFCKF-UHFFFAOYSA-N
C(C(CCl)OP(=O)(OC(CCl)CCl)OC(CCl)CCl)Cl