This compound is a bismaleimide derivative with two maleimide groups connected by a methylene-bridged diphenyl unit. It is primarily significant as an intermediate used in the synthesis of polymers, particularly for high-performance materials.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13676-54-5
2,2,3,3,4,4,4-Heptafluorobutyl methacrylate
fluorinated monomer for polymer synthesis
2-Aminothiophenol
synthesis intermediate for chemical industry
N-Lauroylsarcosine sodium salt
surfactant and foaming agent
Copper dimethyldithiocarbamate
Elastomer accelerator for rubber vulcanization
1-[4-[[4-(2,5-dioxopyrrol-1-yl)phenyl]methyl]phenyl]pyrrole-2,5-dione
XQUPVDVFXZDTLT-UHFFFAOYSA-N
C1=CC(=CC=C1CC2=CC=C(C=C2)N3C(=O)C=CC3=O)N4C(=O)C=CC4=O