Fmoc-L-norvaline is a protected amino acid derivative used in peptide synthesis, where the Fmoc (9-fluorenylmethoxycarbonyl) group shields the amino group during chain assembly. It serves as a building block for incorporating norvaline into custom peptide sequences in laboratory research and pharmaceutical manufacturing.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 135112-28-6
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid for peptide synthesis
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-methionine
Fmoc-protected amino acid for peptide synthesis
D-FMOC-methionine
Protected amino acid for peptide synthesis
Fmoc-beta-t-butyl-L-alanine
peptide synthesis building block
N-((Phenylmethoxy)carbonyl)-L-tyrosine methyl ester
Peptide synthesis protected amino acid
(1S)-1-(3-chlorophenyl)ethan-1-ol
Chiral building block for pharmaceuticals
3-(chloromethyl)-1-methyl-1H-1,2,4-triazole hydrochloride
pharmaceutical intermediate
(R)-2-Hydroxy-1-morpholinopropan-1-one
Pharmaceutical intermediate
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid
JBIJSEUVWWLFGV-SFHVURJKSA-N
CCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13