Didesmethyl Almotriptan-d4 is a deuterated research compound, specifically the tetradeuterio analog of a metabolite of almotriptan. It contains four deuterium atoms at specific positions on the ethanamine side chain, making it useful as an internal standard in analytical studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1346604-75-8
( inverted exclamation markA)-Penbutolol-d9 (hydrochloride)
Deuterated research compound
2-Amino Nevirapine-d3
isotope-labeled research compound
Trans-Abacavir-d4 Hydrochloride
deuterated research standard
(R)-1-Aminoindane-d3 Hydrochloride
deuterated pharmaceutical research standard
Didesmethyl almotriptan hemifumarate
analytical impurity reference standard
Almotriptan-d6 Hydrochloride
deuterated research reference standard
3-[2-(Dimethylamino)ethyl]-5-[(1-pyrrolidinylsulfonyl)methyl]-1H-indole-1-methanol
Pharmaceutical intermediate for almotriptan impurities
2-Hydroxyalmotriptan
impurity of almotriptan synthesis
1,1,2,2-tetradeuterio-2-[5-(pyrrolidin-1-ylsulfonylmethyl)-1H-indol-3-yl]ethanamine
XLDLLAFWGVDYHM-NZLXMSDQSA-N
[2H]C([2H])(C1=CNC2=C1C=C(C=C2)CS(=O)(=O)N3CCCC3)C([2H])([2H])N