Ternidazole-d6 Hydrochloride is a deuterated research compound, specifically a hexadeuterated form of ternidazole where six hydrogen atoms are replaced with deuterium. It is supplied as a hydrochloride salt and is primarily used in research settings, often as a stable isotope-labeled internal standard or tracer.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1346599-62-9
Bis [2-[(2-Amino-1,6-dihydro-6-O-benzyl-9H-purin-9yl)methoxy]ethanol]
acyclovir impurity reference standard
3-O-Methyl Colterol-d9
Isotopically labeled research compound
6-(Desmethyl)-7-methyl zolpidem
Reference standard for analytical testing
Hydroxymethyl Clenbuterol-d6
deuterium-labeled reference standard
2-Methyl-5-nitro-1H-imidazole-1-propanol monohydrochloride
Active pharmaceutical ingredient
Ternidazole
active pharmaceutical ingredient
1,1,2,2,3,3-hexadeuterio-3-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol;hydrochloride
PTXLKVODAFRGDG-RYKMJATISA-N
[2H]C([2H])(C([2H])([2H])N1C(=NC=C1[N+](=O)[O-])C)C([2H])([2H])O.Cl