D-Kynurenine is a research compound and a D-alpha-amino acid that is an enantiomer of L-kynurenine. It is a human metabolite involved in tryptophan metabolism.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
D-Kynurenine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-BROMOCHLOROBENZENE-D4
Deuterated reference standard compound
(1R)-1-(3-chloro-4-fluorophenyl)ethan-1-ol
research compound
(R)-[2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl dichlororuthenium
asymmetric hydrogenation catalyst
Gold triiodide
research compound
3-Anthraniloyl-L-alanine
research compound
3-Anthraniloyl-L-alanine
pharmaceutical intermediate and metabolite
(2R)-2-amino-4-(2-aminophenyl)-4-oxobutanoic acid
YGPSJZOEDVAXAB-MRVPVSSYSA-N
C1=CC=C(C(=C1)C(=O)C[C@H](C(=O)O)N)N
D-Kynurenine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.