4-Bromochlorobenzene-d4 is a deuterated reference standard compound, specifically the tetradeuterated analogue of 1-bromo-4-chlorobenzene where all four aromatic hydrogen atoms are replaced by deuterium. It is primarily used as an internal standard or labeled tracer in analytical chemistry, particularly for mass spectrometry and nuclear magnetic resonance spectroscopy.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 134415-42-2
(1R)-1-(3-chloro-4-fluorophenyl)ethan-1-ol
research compound
(R)-[2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl dichlororuthenium
asymmetric hydrogenation catalyst
Gold triiodide
research compound
2,4-Diphenyl-6-(4,4,5,5-tetramethyl-[1,3,2] dioxaborolan-2-yl)-[1,3,5]triazine
research reagent
1-Bromo-4-chlorobenzene
Chemical intermediate for synthesis
1-bromo-4-chloro-2,3,5,6-tetradeuteriobenzene
NHDODQWIKUYWMW-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1Cl)[2H])[2H])Br)[2H]