Fmoc-Glu(OAll)-OH is a research compound used in peptide synthesis, featuring a fluorenylmethoxycarbonyl (Fmoc) protecting group and an allyl ester side-chain protection. It is employed as a building block for the stepwise assembly of peptides, particularly where orthogonal deprotection strategies are required.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Fmoc-Glu(OAll)-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-glutamic-acid-alpha allyl ester
Fmoc-protected amino acid derivative
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-6-{[(prop-2-en-1-yloxy)carbonyl]amino}hexanoic acid
Protected amino acid for peptide synthesis
Alloc-Lys(Fmoc)-OH
protected amino acid for peptide synthesis
Fmoc-L-aspartic acid
research compound for peptide synthesis
Fmoc-Gln(Trt)-Thr(Psi(Me,Me)pro)-OH
research compound for peptide synthesis
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)glycylglycylglycine
research compound for peptide synthesis
Fmoc-Gln(Trt)-Ser(Psi(Me,Me)pro)-OH
research compound for peptide synthesis
(1,10-Phenanthroline)(trifluoromethyl)(triphenylphosphine)copper(I)
copper catalyst for cross-coupling reactions
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxo-5-prop-2-enoxypentanoic acid
LRBARFFNYOKIAX-FQEVSTJZSA-N
C=CCOC(=O)CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
Fmoc-Glu(OAll)-OH 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.