Fmoc-L-aspartic acid is a research reagent used in peptide synthesis, featuring a fluorenylmethoxycarbonyl (Fmoc) protecting group attached to the amino function of L-aspartic acid. Its significance lies in its role as a building block for the solid-phase synthesis of peptides, enabling controlled chain assembly.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Fmoc-L-aspartic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-methoxy-4-oxobutanoic acid
Protected amino acid for peptide synthesis
Fmoc-L-asparagine
Fmoc-protected amino acid for peptide synthesis
Fmoc-D-Asn-OH
Peptide synthesis reagent
Fmoc-L-cysteine
peptide synthesis intermediate
Fmoc-Glu(OAll)-OH
research compound for peptide synthesis
Fmoc-Ser(tBu)-Thr(Psi(Me,Me)pro)-OH
research compound for peptide synthesis
N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-prolinyl-L-proline
research compound for peptide synthesis
L-Tryptophan, N-[(1,1-dimethylethoxy)carbonyl]-
research compound for peptide synthesis
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)butanedioic acid
KSDTXRUIZMTBNV-INIZCTEOSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC(=O)O)C(=O)O
Fmoc-L-aspartic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.