2,2'-Bithiophene-5-boronic acid is a research compound featuring a boronic acid functional group attached to a bithiophene core. It is primarily used as a building block or intermediate in organic synthesis and materials research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 132898-95-4
Dimethyl 5-nitroisophthalate
research compound
Magnesium, bromo(1-methylethenyl)-
Grignard reagent for organic synthesis
Trichloroethylene-d
deuterated chemical research standard
Borane dimethyl sulfide
Complexed borane reagent for hydroboration and reductions
2,2'-Bithiophene
organic electronic material
(Perfluoro-[2,2'-bithiophene]-5,5'-diyl)bis(trimethylstannane)
research compound for organic electronics
3,3'-DIBROMO-5,5'-BIS(TRIMETHYLSILYL)-2,2'-BITHIOPHENE
Organic synthesis building block
(5-thiophen-2-ylthiophen-2-yl)boronic acid
PPHSULIZZOEBDD-UHFFFAOYSA-N
B(C1=CC=C(S1)C2=CC=CS2)(O)O