Dimethyl 5-nitroisophthalate is a research compound with a nitro-substituted aromatic core and two ester groups. It is primarily used as a reagent in chemical synthesis and laboratory research.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13290-96-5
Methyl 3,5-dinitrobenzoate
research compound
5-Nitroisophthalic acid monomethyl ester
research intermediate for organic synthesis
Magnesium, bromo(1-methylethenyl)-
Grignard reagent for organic synthesis
Trichloroethylene-d
deuterated chemical research standard
Borane dimethyl sulfide
Complexed borane reagent for hydroboration and reductions
2-Methyl-3-isothiazolone-d3 Hydrochloride
deuterated research standard
dimethyl 5-nitrobenzene-1,3-dicarboxylate
GGTSJKFPGKFLCZ-UHFFFAOYSA-N
COC(=O)C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)OC