2-Bromo-3-fluorobenzoic acid is a halogenated benzoic acid derivative used primarily as a research compound. It features both bromine and fluorine substituents on the aromatic ring, contributing to its utility in synthetic chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
2-Bromo-3-fluorobenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Phosphine, dicyclohexyl(1,1-dimethylethyl)-, tetrafluoroborate
Research reagent for organic synthesis
2-(2-Bromophenyl)-1H-benzimidazole
research compound for crystallography studies
1,4-Bis(2-methylstyryl)benzene
Scintillation research reagent
2,2'-Bithiophene-5-boronic acid
research compound
2-bromo-3-fluorobenzoic acid
KQRCBMPPEPNNDS-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)Br)C(=O)O
2-Bromo-3-fluorobenzoic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.