Glycyl-l-glutamine is a dipeptide compound used as a biochemical research reagent. Its structure includes an amine group, two amide groups, and a carboxylic acid, contributing to its polar and hydrophilic character.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Glycyl-l-glutamine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
D-Galactosamine hydrochloride
Biochemical research reagent
5-CHLOROURACIL
Biochemical research reagent
Udp-beta-L-rhamnose
Biochemical research reagent
Adenosine 5'-diphosphate sodium salt
Biochemical research reagent
(2R,4S)-4-fluoropyrrolidine-2-carboxylic acid
research compound
N-(2-PYRIDYL)OXAMIC ACID
research compound
Rhodium(2+) (2S)-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-phenylpropanoate--ethyl acetate (2/4/1)
research compound for catalysis
Benzene-d, 4-bromo-
deuterated research compound
(2S)-5-amino-2-[(2-aminoacetyl)amino]-5-oxopentanoic acid
PNMUAGGSDZXTHX-BYPYZUCNSA-N
C(CC(=O)N)[C@@H](C(=O)O)NC(=O)CN
Glycyl-l-glutamine 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.