D-Galactosamine hydrochloride is a biochemical research reagent consisting of the hydrochloride salt of the amino sugar D-galactosamine. It is commonly employed in laboratory studies to investigate liver function and metabolism due to its selective hepatotoxic effects.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1772-03-8
Udp-beta-L-rhamnose
Biochemical research reagent
4-Hydroxyisoleucine
Biochemical research reagent
5-CHLOROURACIL
Biochemical research reagent
Adenosine 5'-diphosphate sodium salt
Biochemical research reagent
Palmityl-C6 amino Phosphoramidite
lipid-based research reagent
Uridine diphosphate choline sodium salt
nucleotide sugar research reagent
Trimethylsulfoxonium iodide
Research reagent and chemical intermediate
(3R,6S,9S,12E,16S)-9-(4-Aminobutyl)-3-[(4-benzoylphenyl)methyl]-6-(cyclohexylmethyl)-2,5,8,11,14-pentaoxo-1,4,7,10,15-pentaazacycloeicos-12-ene-16-carboxamide
research compound
(2R,3R,4R,5R)-2-amino-3,4,5,6-tetrahydroxyhexanal;hydrochloride
CBOJBBMQJBVCMW-NQZVPSPJSA-N
C([C@H]([C@@H]([C@@H]([C@H](C=O)N)O)O)O)O.Cl