2'-Deoxycytidine-5'-monophosphate disodium salt is a nucleotide compound serving as a key intermediate in the synthesis of pharmaceutical nucleotides. It consists of a deoxycytidine monophosphate backbone in a disodium salt form, characterized by high polarity and a salt-like structure.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 13085-50-2
Cytidine 5'-(trihydrogen diphosphate), 2'-deoxy-, disodium salt
Research reagent for biochemistry
2'-Deoxycytidine-5'-triphosphate trisodium salt
nucleotide analog research reagent
2'-Deoxycytidine 5'-triphosphate disodium salt
nucleotide for DNA synthesis
Methyl 3,3,3-trifluoro-2-oxopropanoate
Pharmaceutical intermediate for trifluoromethylated compounds
N-benzoylcytidine
Pharmaceutical intermediate for nucleoside synthesis
4-Chloro-3-nitropyridine
Pharmaceutical intermediate for synthesis
2-Hydroxyalmotriptan
impurity of almotriptan synthesis
DCMP
Nucleotide research standard
disodium;[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl phosphate
IJFRULGDDRUYQN-CDNBRZBRSA-L
C1[C@@H]([C@H](O[C@H]1N2C=CC(=NC2=O)N)COP(=O)([O-])[O-])O.[Na+].[Na+]