dCMP (2'-deoxycytidine 5'-monophosphate) is a nucleotide monophosphate that serves as a fundamental building block in DNA research. It is a metabolite found in Escherichia coli and is primarily used as a research standard in nucleotide studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1032-65-1
DCTP
nucleotide triphosphate for DNA synthesis
Cytidine 5'-(trihydrogen diphosphate), 2'-deoxy-, disodium salt
Research reagent for biochemistry
2'-Deoxycytidine-5'-triphosphate trisodium salt
nucleotide analog research reagent
Fmoc-L-Cys(Trt)-OH
side chain protected amino acid
3'-o-aminothymidine
research compound
4-Methoxy-1H-indole-2-carboxylic acid
Research compound for indole chemistry
N,N-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine
research reagent for boronic ester
2'-Deoxycytidine-5'-monophosphate disodium salt
nucleotide intermediate for pharmaceutical synthesis
[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate
NCMVOABPESMRCP-SHYZEUOFSA-N
C1[C@@H]([C@H](O[C@H]1N2C=CC(=NC2=O)N)COP(=O)(O)O)O