This compound is a chiral diol compound used primarily as a research reagent. Its structure features two alcohol functional groups and defined stereochemistry, making it of interest for laboratory studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(3S,6S)-2,7-Dimethyl-3,6-octanediol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
(trans,trans)-4-Pentyl-4'-vinyl-1,1'-bi(cyclohexane)
liquid crystal intermediate
2'-o-propargyluridine
research compound for nucleic acid modification
DSPACER CEP
oligonucleotide synthesis building block
2-Amino-4-bromo-3-methylbenzoic acid
research compound
(3R,6R)-2,7-dimethyloctane-3,6-diol
research compound
(3S,6S)-2,7-dimethyloctane-3,6-diol
IIEGQVRKIRPFFP-UWVGGRQHSA-N
CC(C)[C@H](CC[C@@H](C(C)C)O)O
—
(3S,6S)-2,7-Dimethyl-3,6-octanediol 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.