DSPACER CEP is a phosphoramidite reagent used as a building block in oligonucleotide synthesis. Its highly flexible structure is noted in chemical databases due to the large number of rotatable bonds.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
DSPACER CEP 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Reverse Abasic Phosphoramidite
Phosphoramidite reagent for oligonucleotide synthesis
DMTr-LNA-C(Bz)-3-CED-phosphoramidite
oligonucleotide synthesis building block
Bz-rC Phosphoramidite
oligonucleotide synthesis building block
2-Amino-4-bromo-3-methylbenzoic acid
research compound
2-((2-Fluorophenyl)thio)-5-(methylsulfonyl)aniline
research compound
N-Desmethyl Clobazam-d5
Deuterated analytical reference standard
Clobazam-d5 (1.0mg/ml in Methanol)
deuterated internal standard
4-(((2R,3S)-2-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)tetrahydrofuran-3-yl)oxy)-4-oxobutanoic acid
n.a
3-[[(2R,3S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile
XZGSDLJMHWJDHL-JUWSMZLESA-N
CC(C)N(C(C)C)P(OCCC#N)O[C@H]1CCO[C@@H]1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC
DSPACER CEP 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.