This compound is a pentafluoro-λ6-sulfane-substituted phenylboronic ester used as a synthetic building block in chemical research. It features an aromatic ring with a boronate ester group and multiple fluorine atoms, contributing to its potential utility in cross-coupling reactions and molecular design.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1286278-34-9
(R)-N-(Piperidin-3-yl)acetamide
research compound
7,9-Dimesityl-7H-acenaphtho[1,2-d]imidazol-9-ium chloride
ligand for chemical synthesis
Bis(eta(5)-cyclopentadienyl)ruthenium;bis(eta(5)-cyclopentadienyl)ruthenium(II)
research compound
Methyl N-[6-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-1H-benzimidazol-2-yl]carbamate
Deuterated labelled research compound
pentafluoro-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-lambda6-sulfane
GSABJOBFIHVJIB-UHFFFAOYSA-N
B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)S(F)(F)(F)(F)F
—