This compound is a metallocene consisting of a ruthenium atom bound between two cyclopentadiene rings. It is identified as a research reagent and is commonly used in laboratory settings for synthetic and coordination chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1287-13-4
Dicyclopentadienyliron
antiknock gasoline additive
Methyl N-[6-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-1H-benzimidazol-2-yl]carbamate
Deuterated labelled research compound
(-)-Butorphanol-d6
pharmaceutical reference standard
4-(Trifluoromethyl)phenylboronic acid
research compound for organic synthesis
5H-Cyclohepta[b]pyridine, 5-azido-6-(2,3-difluorophenyl)-6,7,8,9-tetrahydro-9-[[tris(1-methylethyl)silyl]oxy]-, (5S,6S,9R)-
research compound
Ethylferrocene
organoiron compound for chemical synthesis
BKEJVRMLCVMJLG-UHFFFAOYSA-N
C1=C[CH]C=C1.C1=C[CH]C=C1.[Ru]