This compound is a metallocene consisting of a ruthenium atom bound between two cyclopentadiene rings. It is identified as a research reagent and is commonly used in laboratory settings for synthetic and coordination chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Dicyclopentadienyliron
antiknock gasoline additive
Methyl N-[6-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-1H-benzimidazol-2-yl]carbamate
Deuterated labelled research compound
(-)-Butorphanol-d6
pharmaceutical reference standard
4-(Trifluoromethyl)phenylboronic acid
research compound for organic synthesis
5H-Cyclohepta[b]pyridine, 5-azido-6-(2,3-difluorophenyl)-6,7,8,9-tetrahydro-9-[[tris(1-methylethyl)silyl]oxy]-, (5S,6S,9R)-
research compound
Ethylferrocene
organoiron compound for chemical synthesis
Bis(eta(5)-cyclopentadienyl)ruthenium;bis(eta(5)-cyclopentadienyl)ruthenium(II)(CAS 1287-13-4)의 국제 HS 코드는 2843.90입니다.
2843.90
2843 90 90
EU 세관 화학물질 목록 ECICS(2026-07 스냅숏, HS 2022)에 따른 분류입니다. 국가별 세부 세번과 제품 형태에 따라 최종 분류가 달라질 수 있습니다.
BKEJVRMLCVMJLG-UHFFFAOYSA-N
C1=C[CH]C=C1.C1=C[CH]C=C1.[Ru]
이 화합물 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.