(3,5-Diphenylphenyl)boronic acid is a boronic acid reagent used in chemical synthesis. It features three aromatic rings and is commonly employed as a building block in organic chemistry.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 128388-54-5
5-Chlorobiphenyl-3-ylboronic acid
Suzuki coupling reagent
3-Tolylboronic acid
Boronic acid reagent for synthesis
Cyclohexylboronic Acid (contains varying amounts of Anhydride)
Boronic acid reagent for synthesis
Biphenyl-2-boronic acid
Boronic acid reagent for synthesis
4-Iodophenylboronic acid
Boronic acid reagent for synthesis
Sodium;[hydroxy-[hydroxy-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxyphosphoryl] hydrogen phosphate
research compound
1-(naphthalen-2-yl)-2-(piperidin-1-yl)ethane-1,2-dione
research compound
Fenoterol-d6 Hydrobromide
Isotopically labelled research compound
(3,5-diphenylphenyl)boronic acid
MRBZYVMZUBUDAX-UHFFFAOYSA-N
B(C1=CC(=CC(=C1)C2=CC=CC=C2)C3=CC=CC=C3)(O)O