Biphenyl-2-boronic acid is a boronic acid reagent commonly used in organic synthesis. It consists of two aromatic rings with a boronic acid functional group, making it suitable for Suzuki-type coupling reactions.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Biphenyl-2-boronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
[2-(3-phenylphenyl)phenyl]boronic acid
Electronic chemical intermediate
(2,4-dimethylphenyl)boronic Acid
Boronic acid reagent for synthesis
Cyclohexylboronic Acid (contains varying amounts of Anhydride)
Boronic acid reagent for synthesis
4-Iodophenylboronic acid
Boronic acid reagent for synthesis
Thiophene-3-boronic acid
Boronic acid reagent for synthesis
1-Kestose
reference standard for fructooligosaccharides
5-Bromothiophene-2-carbaldehyde
research compound
Tris(3-hydroxypropyl)phosphine
reductant for vitamin K epoxide reductase assay
(2-phenylphenyl)boronic acid
HYCYKHYFIWHGEX-UHFFFAOYSA-N
B(C1=CC=CC=C1C2=CC=CC=C2)(O)O
Biphenyl-2-boronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.