This compound is a deuterated derivative of 3,4-dichlorobiphenyl, a polychlorinated biphenyl (PCB) analog. It is primarily used as an analytical reference standard in research, particularly for mass spectrometry and internal standard applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
3,4-Dichlorobiphenyl-2',3',4',5',6'-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Hydroxy Atrazine-d5
deuterated analytical reference standard
3,5-Dichlorobiphenyl-2',3',4',5',6'-d5
deuterated reference standard
(Rac)-Atropine-d3
deuterated analytical reference standard
2-Chloroaniline-d6
deuterated research standard
1,2,3,4,5-pentadeuterio-6-(3,4-dichlorophenyl)benzene
ZGHQUYZPMWMLBM-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC(=C(C=C2)Cl)Cl)[2H])[2H]
3,4-Dichlorobiphenyl-2',3',4',5',6'-d5 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.