This compound is a deuterated derivative of 3,4-dichlorobiphenyl, a polychlorinated biphenyl (PCB) analog. It is primarily used as an analytical reference standard in research, particularly for mass spectrometry and internal standard applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1276197-19-3
Hydroxy Atrazine-d5
deuterated analytical reference standard
3,5-Dichlorobiphenyl-2',3',4',5',6'-d5
deuterated reference standard
(Rac)-Atropine-d3
deuterated analytical reference standard
2-Chloroaniline-d6
deuterated research standard
1,2,3,4,5-pentadeuterio-6-(3,4-dichlorophenyl)benzene
ZGHQUYZPMWMLBM-RALIUCGRSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=CC(=C(C=C2)Cl)Cl)[2H])[2H]