(Rac)-Atropine-d3 is a deuterated analytical reference standard used primarily in laboratory and research settings. It is structurally related to atropine, featuring a tropane ring system and an ester functional group, and is employed as a labeled compound for analytical chemistry and quality control applications.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
(Rac)-Atropine-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-Chloroaniline-d6
deuterated research standard
(+/-)-Carazolol-d7 HCl (iso-propyl-d7)
Deuterated research standard
(1R,2S)-1-phenyl-2-(pyrrolidin-1-yl)propan-1-ol
research compound
4-Hydroxy Midazolam-d5 Methanoate
deuterated reference standard
아트로핀
active pharmaceutical ingredient
Atropine sulfate
active pharmaceutical ingredient
Atropine sulfate monohydrate
active pharmaceutical ingredient
Anaspaz
active pharmaceutical ingredient
[8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate
RKUNBYITZUJHSG-FIBGUPNXSA-N
[2H]C([2H])([2H])N1C2CCC1CC(C2)OC(=O)C(CO)C3=CC=CC=C3
(Rac)-Atropine-d3 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.