This compound is a palladium complex coordinated with a chiral diphosphine ligand, commonly known as a dichloropalladium(II) complex of 2,2'-bis(diphenylphosphino)-1,1'-binaphthalene. It is primarily utilized as a catalyst in asymmetric synthesis research due to its ability to induce enantioselectivity in various organic transformations.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 127593-28-6
(S)-RuCl[(p-cymene(BINAP)Cl
asymmetric hydrogenation catalyst
(R)-[2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl dichlororuthenium
chiral ruthenium catalyst for asymmetric synthesis
(S)-RuCl[(p-cymene(BINAP)Cl
asymmetric hydrogenation catalyst
CIS-((S)-BINAP)NI(O-TOLYL)CL
asymmetric catalysis research reagent
4-NITROTOLUENE-2,3,5,6-D4
deuterated research reagent
Ractopamine-d6 Hydrochloride
deuterated internal standard for analysis
3,4-Dichlorobiphenyl-2',3',4',5',6'-d5
Deuterated analytical reference standard
Hydroxy Atrazine-d5
deuterated analytical reference standard
dichloropalladium;[1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane
VDHAUMFISVWIRX-UHFFFAOYSA-L
C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=CC=C7)C8=CC=CC=C8.Cl[Pd]Cl