Aminofluoro hydroxybenzoate is a research compound with a complex aromatic ester structure. It is characterized by the presence of amine, ether, and halogen functional groups, and is used primarily in laboratory research settings.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Aminofluoro hydroxybenzoate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
4-(naphthalen-1-yl)aniline
research compound
((Z)-2-((3R,4R,5R)-3,5-Bis((tert-butyldimethylsilyl)oxy)-4-(3-((tert-butyldiphenylsilyl)oxy)propoxy)-2-methylenecyclohexylidene)ethyl)diphenylphosphine oxide
chemical research reagent
4-Fluoro(phenyl-d4)-boronic acid
research compound
2-(4-Fluorophenyl)-7,8-dimethoxyquinolin-4(1H)-one
research compound
phenyl 5-(dibenzylamino)-3-fluoro-2-methyl-6-phenylmethoxybenzoate
VRXGVVAMXZXKNA-UHFFFAOYSA-N
CC1=C(C=C(C(=C1C(=O)OC2=CC=CC=C2)OCC3=CC=CC=C3)N(CC4=CC=CC=C4)CC5=CC=CC=C5)F
Aminofluoro hydroxybenzoate 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.