4-Fluoro(phenyl-d4)-boronic acid is a deuterated research compound containing a boronic acid functional group and a fluorine atom. Its primary significance lies in its use as a labeled reagent for analytical and synthetic chemistry studies.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
4-Fluoro(phenyl-d4)-boronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
2-(4-Fluorophenyl)-7,8-dimethoxyquinolin-4(1H)-one
research compound
4-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-9H-CARBAZOLE
Borylation reagent for organic synthesis
2-Bromo-1,3-oxazole
Research reagent
Methyl-13C phenyl sulfone
isotopic labeled research compound
4-Fluorophenylboronic acid
Boronic acid research reagent
(2,3,5,6-tetradeuterio-4-fluorophenyl)boronic acid
LBUNNMJLXWQQBY-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1B(O)O)[2H])[2H])F)[2H]
—
4-Fluoro(phenyl-d4)-boronic acid 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.