AMPPD disodium salt is a chemiluminescent substrate used primarily in research for detecting alkaline phosphatase activity. The compound consists of a spiroadamantane-dioxetane core with a phosphate group, which upon enzymatic cleavage produces a light signal.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 124951-96-8
Phosphoric acid--trioxotungsten--water (1/12/1)
histochemical staining reagent
7-(m-tolyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide
research compound
(R)-3-(1-HYDROXYETHYL)BENZOIC ACID
Research reagent
Aminofluoro hydroxybenzoate
research compound
disodium;[3-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] phosphate
YADDZULXACVKHE-UHFFFAOYSA-L
COC1(C2(C3CC4CC(C3)CC2C4)OO1)C5=CC(=CC=C5)OP(=O)([O-])[O-].[Na+].[Na+]