Bistris hydrochloride is a buffering agent commonly used in biochemical and molecular biology research. It is a hydrochloride salt form of Bistris, a tertiary amine with multiple hydroxyl groups, known for its high water solubility and low ionic strength over a useful pH range.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
Bistris hydrochloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.
Bis-tris
Buffer and complexing agent
Methyl 3-(2-methoxy-5-methylphenyl)-3-phenylpropionate
dopamine D1/D5 full agonist
3-(2-Methoxy-5-methylphenyl)-3-phenyl propanol
research compound
AMPPD DISODIUM SALT
Chemiluminescent substrate for alkaline phosphatase
Phosphoric acid--trioxotungsten--water (1/12/1)
histochemical staining reagent
2-[bis(2-hydroxyethyl)amino]-2-(hydroxymethyl)propane-1,3-diol;hydrochloride
VEYRVLHAMHQVTC-UHFFFAOYSA-N
C(CO)N(CCO)C(CO)(CO)CO.Cl
Bistris hydrochloride 구매를 찾고 계신가요?
구매 요청을 무료로 등록하세요. 계정이 필요 없습니다. 이 제품을 공급할 수 있는 공급업체에 전달되며, 답변은 이메일로 바로 받습니다.