This compound is a deuterated research reagent derived from a piperazine-benzoic acid structure, featuring a chlorophenylbenzyl substituent and multiple deuterium atoms. It is primarily used in laboratory settings for analytical and metabolic studies due to its stable isotope labeling.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1246819-26-0
Epsilon-Aminocaproic Acid-d10 Hydrochloride
research reagent for pharmacokinetic studies
1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]ethanol
deuterated research standard
3,4-Diaminotoluene-d6
deuterated reference standard
Carbanide;cyclopentene;ditert-butyl-[(1S)-1-(2-dicyclohexylphosphanylcyclopentyl)ethyl]phosphane;iron(2+)
organometallic catalyst ligand complex
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]benzoic acid
FSHGEKXJPYDBSO-DBVREXLBSA-N
[2H]C1(C(N(C(C(N1CC2=CC=CC=C2C3=CC=C(C=C3)Cl)([2H])[2H])([2H])[2H])C4=CC=C(C=C4)C(=O)O)([2H])[2H])[2H]
—