This compound is an electronic material precursor featuring a boronic acid group attached to a carbazole-based aromatic structure. It is primarily used in the development of organic electronic materials.
콘텐츠 범위: 이 페이지의 정보는 화학물질 식별 및 산업 공급·연구개발·제조 맥락을 대상으로 합니다. 치료 효능 주장, 의료 조언 또는 의약품 사용 지침에 해당하지 않습니다.
이 화합물을 구매하거나 공급하시겠습니까?
재고를 등록하거나 구매 요청을 게시하세요
CAS 1240963-55-6
6,9-Diphenyl-9H-carbazole-3-boronic Acid (contains varying amounts of Anhydride)
organic synthesis intermediate
9-phenyl-9H-carbazole-3-boronic acid
organic synthesis reagent
N-[4-(1-naphthyl)phenyl]-4-(4-phenylphenyl)aniline
electronic chemical for organic electronics
(9,9-Dimethyl-9H-fluoren-3-yl)boronic acid
OLED materials
N-phenyl dibenzothiophen-4-amine
Electronic chemical for OLED materials
3-Bromonaphtho[2,3-b]benzofuran
OLED intermediate
3-(4-Bromophenyl)-9-phenylcarbazole
OLED material intermediate
[4-(9-phenylcarbazol-3-yl)phenyl]boronic acid
CFZRUXMJHALVPF-UHFFFAOYSA-N
B(C1=CC=C(C=C1)C2=CC3=C(C=C2)N(C4=CC=CC=C43)C5=CC=CC=C5)(O)O
—